C26H26F3NO — CID 177429792
(E)-N,N-dibenzyl-1,1,1-trifluoro-5-(4-methoxyphenyl)pent-2-en-2-amine (PubChem CID 177429792) has the molecular formula C26H26F3NO and a molecular weight of 425.49 g/mol. Its IUPAC name is (E)-N,N-dibenzyl-1,1,1-trifluoro-5-(4-methoxyphenyl)pent-2-en-2-amine.
| Compound Name | (E)-N,N-dibenzyl-1,1,1-trifluoro-5-(4-methoxyphenyl)pent-2-en-2-amine |
|---|---|
| PubChem CID | 177429792 |
| Molecular Formula | C26H26F3NO |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | (E)-N,N-dibenzyl-1,1,1-trifluoro-5-(4-methoxyphenyl)pent-2-en-2-amine |
| SMILES | COc1ccc(CC/C=C(/N(Cc2ccccc2)Cc2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H26F3NO/c1-31-24-17-15-21(16-18-24)13-8-14-25(26(27,28)29)30(19-22-9-4-2-5-10-22)20-23-11-6-3-7-12-23/h2-7,9-12,14-18H,8,13,19-20H2,1H3/b25-14+ |
| InChIKey | RNWXCKLURGZGMG-AFUMVMLFSA-N |
| XLogP | 6.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |