C11H8N2 — CID 177430449
N-cyclopenta-1,2,4-trien-1-yl-1-pyridin-2-ylmethanimine (PubChem CID 177430449) has the molecular formula C11H8N2 and a molecular weight of 168.20 g/mol. Its IUPAC name is N-cyclopenta-1,2,4-trien-1-yl-1-pyridin-2-ylmethanimine.
| Compound Name | N-cyclopenta-1,2,4-trien-1-yl-1-pyridin-2-ylmethanimine |
|---|---|
| PubChem CID | 177430449 |
| Molecular Formula | C11H8N2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | N-cyclopenta-1,2,4-trien-1-yl-1-pyridin-2-ylmethanimine |
| SMILES | C1=CC=CC=1/N=C/c1ccccn1 |
| InChI | InChI=1S/C11H8N2/c1-2-6-10(5-1)13-9-11-7-3-4-8-12-11/h1-5,7-9H/b13-9+ |
| InChIKey | UYAFQSOFDKYPRA-UKTHLTGXSA-N |
| XLogP | 2.11 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|