C16H21NO3 — CID 177430650
(1S,2R,4S)-N-(furan-2-ylmethyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 177430650) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is (1S,2R,4S)-N-(furan-2-ylmethyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2R,4S)-N-(furan-2-ylmethyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 177430650 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (1S,2R,4S)-N-(furan-2-ylmethyl)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)C(=O)[C@@H]2C(=O)NCc1ccco1 |
| InChI | InChI=1S/C16H21NO3/c1-15(2)11-6-7-16(15,3)13(18)12(11)14(19)17-9-10-5-4-8-20-10/h4-5,8,11-12H,6-7,9H2,1-3H3,(H,17,19)/t11-,12+,16+/m0/s1 |
| InChIKey | YRDOETHDMMXTLR-HWWQOWPSSA-N |
| XLogP | 2.54 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|