C23H22N2O5 — CID 177432205
11-amino-6-(hydroxymethyl)-9-(2-methoxyphenyl)-2,7-dioxa-18-azatetracyclo[8.8.0.03,8.012,17]octadeca-1(18),3(8),5,10,12(17)-pentaen-4-one (PubChem CID 177432205) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is 11-amino-6-(hydroxymethyl)-9-(2-methoxyphenyl)-2,7-dioxa-18-azatetracyclo[8.8.0.03,8.012,17]octadeca-1(18),3(8),5,10,12(17)-pentaen-4-one.
| Compound Name | 11-amino-6-(hydroxymethyl)-9-(2-methoxyphenyl)-2,7-dioxa-18-azatetracyclo[8.8.0.03,8.012,17]octadeca-1(18),3(8),5,10,12(17)-pentaen-4-one |
|---|---|
| PubChem CID | 177432205 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 11-amino-6-(hydroxymethyl)-9-(2-methoxyphenyl)-2,7-dioxa-18-azatetracyclo[8.8.0.03,8.012,17]octadeca-1(18),3(8),5,10,12(17)-pentaen-4-one |
| SMILES | COc1ccccc1C1c2oc(CO)cc(=O)c2Oc2nc3c(c(N)c21)CCCC3 |
| InChI | InChI=1S/C23H22N2O5/c1-28-17-9-5-3-7-14(17)18-19-20(24)13-6-2-4-8-15(13)25-23(19)30-21-16(27)10-12(11-26)29-22(18)21/h3,5,7,9-10,18,26H,2,4,6,8,11H2,1H3,(H2,24,25) |
| InChIKey | MITYROHUPHBGDO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |