C22H32N4O2+2 — CID 177432986
2,5-bis(3-pentylimidazol-3-ium-1-yl)benzene-1,4-diol (PubChem CID 177432986) has the molecular formula C22H32N4O2+2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 2,5-bis(3-pentylimidazol-3-ium-1-yl)benzene-1,4-diol.
| Compound Name | 2,5-bis(3-pentylimidazol-3-ium-1-yl)benzene-1,4-diol |
|---|---|
| PubChem CID | 177432986 |
| Molecular Formula | C22H32N4O2+2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 2,5-bis(3-pentylimidazol-3-ium-1-yl)benzene-1,4-diol |
| SMILES | CCCCC[n+]1ccn(-c2cc(O)c(-n3cc[n+](CCCCC)c3)cc2O)c1 |
| InChI | InChI=1S/C22H30N4O2/c1-3-5-7-9-23-11-13-25(17-23)19-15-22(28)20(16-21(19)27)26-14-12-24(18-26)10-8-6-4-2/h11-18H,3-10H2,1-2H3/p+2 |
| InChIKey | NDZRPIFSHJSNMB-UHFFFAOYSA-P |
| XLogP | 3.63 |
| TPSA | 58.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|