C20H31F6N2P — CID 86653225
1-octyl-3-(2,4,6-trimethylphenyl)imidazol-1-ium hexafluorophosphate (PubChem CID 86653225) has the molecular formula C20H31F6N2P and a molecular weight of 444.44 g/mol. Its IUPAC name is 1-octyl-3-(2,4,6-trimethylphenyl)imidazol-1-ium hexafluorophosphate.
| Compound Name | 1-octyl-3-(2,4,6-trimethylphenyl)imidazol-1-ium hexafluorophosphate |
|---|---|
| PubChem CID | 86653225 |
| Molecular Formula | C20H31F6N2P |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 1-octyl-3-(2,4,6-trimethylphenyl)imidazol-1-ium hexafluorophosphate |
| SMILES | CCCCCCCC[n+]1ccn(-c2c(C)cc(C)cc2C)c1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C20H31N2.F6P/c1-5-6-7-8-9-10-11-21-12-13-22(16-21)20-18(3)14-17(2)15-19(20)4;1-7(2,3,4,5)6/h12-16H,5-11H2,1-4H3;/q+1;-1 |
| InChIKey | IQVSUPHWEIKDON-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|