C28H36Br2N4 — CID 56955466
1-(2,4,6-trimethylphenyl)-3-[4-[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]butyl]imidazol-3-ium dibromide (PubChem CID 56955466) has the molecular formula C28H36Br2N4 and a molecular weight of 588.43 g/mol. Its IUPAC name is 1-(2,4,6-trimethylphenyl)-3-[4-[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]butyl]imidazol-3-ium dibromide.
| Compound Name | 1-(2,4,6-trimethylphenyl)-3-[4-[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]butyl]imidazol-3-ium dibromide |
|---|---|
| PubChem CID | 56955466 |
| Molecular Formula | C28H36Br2N4 |
| Molecular Weight | 588.43 g/mol |
| Exact Mass | 586.13 |
| IUPAC Name | 1-(2,4,6-trimethylphenyl)-3-[4-[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]butyl]imidazol-3-ium dibromide |
| SMILES | Cc1cc(C)c(-n2cc[n+](CCCC[n+]3ccn(-c4c(C)cc(C)cc4C)c3)c2)c(C)c1.[Br-].[Br-] |
| InChI | InChI=1S/C28H36N4.2BrH/c1-21-15-23(3)27(24(4)16-21)31-13-11-29(19-31)9-7-8-10-30-12-14-32(20-30)28-25(5)17-22(2)18-26(28)6;;/h11-20H,7-10H2,1-6H3;2*1H/q+2;;/p-2 |
| InChIKey | WMVRVQRWWZMFPA-UHFFFAOYSA-L |
| XLogP | -0.82 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.43 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|