C20H20ClN4+ — CID 139189238
2-chloro-1-[[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]methyl]benzimidazole (PubChem CID 139189238) has the molecular formula C20H20ClN4+ and a molecular weight of 351.86 g/mol. Its IUPAC name is 2-chloro-1-[[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]methyl]benzimidazole.
| Compound Name | 2-chloro-1-[[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]methyl]benzimidazole |
|---|---|
| PubChem CID | 139189238 |
| Molecular Formula | C20H20ClN4+ |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 2-chloro-1-[[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]methyl]benzimidazole |
| SMILES | Cc1cc(C)c(-n2cc[n+](Cn3c(Cl)nc4ccccc43)c2)c(C)c1 |
| InChI | InChI=1S/C20H20ClN4/c1-14-10-15(2)19(16(3)11-14)24-9-8-23(12-24)13-25-18-7-5-4-6-17(18)22-20(25)21/h4-12H,13H2,1-3H3/q+1 |
| InChIKey | FPSLBGBNLBBKRH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|