C25H45NO6 — CID 177433078
2-[bis(1-carboxyethyl)-[(E)-hexadec-11-enyl]azaniumyl]propanoate (PubChem CID 177433078) has the molecular formula C25H45NO6 and a molecular weight of 455.64 g/mol. Its IUPAC name is 2-[bis(1-carboxyethyl)-[(E)-hexadec-11-enyl]azaniumyl]propanoate.
| Compound Name | 2-[bis(1-carboxyethyl)-[(E)-hexadec-11-enyl]azaniumyl]propanoate |
|---|---|
| PubChem CID | 177433078 |
| Molecular Formula | C25H45NO6 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.32 |
| IUPAC Name | 2-[bis(1-carboxyethyl)-[(E)-hexadec-11-enyl]azaniumyl]propanoate |
| SMILES | CCCC/C=C/CCCCCCCCCC[N+](C(C)C(=O)[O-])(C(C)C(=O)O)C(C)C(=O)O |
| InChI | InChI=1S/C25H45NO6/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-26(20(2)23(27)28,21(3)24(29)30)22(4)25(31)32/h8-9,20-22H,5-7,10-19H2,1-4H3,(H2-,27,28,29,30,31,32)/b9-8+ |
| InChIKey | JSUUTFUCMWMLOL-CMDGGOBGSA-N |
| XLogP | 4.15 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|