C18H31NO6 — CID 177489287
2-[bis(1-carboxyethyl)-non-8-enylazaniumyl]propanoate (PubChem CID 177489287) has the molecular formula C18H31NO6 and a molecular weight of 357.45 g/mol. Its IUPAC name is 2-[bis(1-carboxyethyl)-non-8-enylazaniumyl]propanoate.
| Compound Name | 2-[bis(1-carboxyethyl)-non-8-enylazaniumyl]propanoate |
|---|---|
| PubChem CID | 177489287 |
| Molecular Formula | C18H31NO6 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 2-[bis(1-carboxyethyl)-non-8-enylazaniumyl]propanoate |
| SMILES | C=CCCCCCCC[N+](C(C)C(=O)[O-])(C(C)C(=O)O)C(C)C(=O)O |
| InChI | InChI=1S/C18H31NO6/c1-5-6-7-8-9-10-11-12-19(13(2)16(20)21,14(3)17(22)23)15(4)18(24)25/h5,13-15H,1,6-12H2,2-4H3,(H2-,20,21,22,23,24,25) |
| InChIKey | AMCPQYIZBKHXPA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|