C36H66CaN2O10+2 — CID 101281942
calcium bis(2-[1-carboxypropyl-(2-hydroxyethyl)-oct-7-enylazaniumyl]butanoate) (PubChem CID 101281942) has the molecular formula C36H66CaN2O10+2 and a molecular weight of 727.01 g/mol. Its IUPAC name is calcium bis(2-[1-carboxypropyl-(2-hydroxyethyl)-oct-7-enylazaniumyl]butanoate).
| Compound Name | calcium bis(2-[1-carboxypropyl-(2-hydroxyethyl)-oct-7-enylazaniumyl]butanoate) |
|---|---|
| PubChem CID | 101281942 |
| Molecular Formula | C36H66CaN2O10+2 |
| Molecular Weight | 727.01 g/mol |
| Exact Mass | 726.43 |
| IUPAC Name | calcium bis(2-[1-carboxypropyl-(2-hydroxyethyl)-oct-7-enylazaniumyl]butanoate) |
| SMILES | C=CCCCCCC[N+](CCO)(C(CC)C(=O)[O-])C(CC)C(=O)O.C=CCCCCCC[N+](CCO)(C(CC)C(=O)[O-])C(CC)C(=O)O.[Ca+2] |
| InChI | InChI=1S/2C18H33NO5.Ca/c2*1-4-7-8-9-10-11-12-19(13-14-20,15(5-2)17(21)22)16(6-3)18(23)24;/h2*4,15-16,20H,1,5-14H2,2-3H3,(H-,21,22,23,24);/q;;+2 |
| InChIKey | SGANQTMBNGCFAU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 195.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.01 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|