C16H30NO5+ — CID 101279620
bis(1-carboxyethyl)-(2-hydroxyethyl)-oct-7-enylazanium (PubChem CID 101279620) has the molecular formula C16H30NO5+ and a molecular weight of 316.42 g/mol. Its IUPAC name is bis(1-carboxyethyl)-(2-hydroxyethyl)-oct-7-enylazanium.
| Compound Name | bis(1-carboxyethyl)-(2-hydroxyethyl)-oct-7-enylazanium |
|---|---|
| PubChem CID | 101279620 |
| Molecular Formula | C16H30NO5+ |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | bis(1-carboxyethyl)-(2-hydroxyethyl)-oct-7-enylazanium |
| SMILES | C=CCCCCCC[N+](CCO)(C(C)C(=O)O)C(C)C(=O)O |
| InChI | InChI=1S/C16H29NO5/c1-4-5-6-7-8-9-10-17(11-12-18,13(2)15(19)20)14(3)16(21)22/h4,13-14,18H,1,5-12H2,2-3H3,(H-,19,20,21,22)/p+1 |
| InChIKey | LRSUTKXAESWWTI-UHFFFAOYSA-O |
| XLogP | 1.88 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|