C16H29NNaO5+ — CID 101279633
sodium 2-[1-carboxyethyl-(2-hydroxyethyl)-[(E)-oct-6-enyl]azaniumyl]propanoate (PubChem CID 101279633) has the molecular formula C16H29NNaO5+ and a molecular weight of 338.40 g/mol. Its IUPAC name is sodium 2-[1-carboxyethyl-(2-hydroxyethyl)-[(E)-oct-6-enyl]azaniumyl]propanoate.
| Compound Name | sodium 2-[1-carboxyethyl-(2-hydroxyethyl)-[(E)-oct-6-enyl]azaniumyl]propanoate |
|---|---|
| PubChem CID | 101279633 |
| Molecular Formula | C16H29NNaO5+ |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | sodium 2-[1-carboxyethyl-(2-hydroxyethyl)-[(E)-oct-6-enyl]azaniumyl]propanoate |
| SMILES | C/C=C/CCCCC[N+](CCO)(C(C)C(=O)[O-])C(C)C(=O)O.[Na+] |
| InChI | InChI=1S/C16H29NO5.Na/c1-4-5-6-7-8-9-10-17(11-12-18,13(2)15(19)20)14(3)16(21)22;/h4-5,13-14,18H,6-12H2,1-3H3,(H-,19,20,21,22);/q;+1/b5-4+; |
| InChIKey | JDDRDLIRZYCSQD-FXRZFVDSSA-N |
| XLogP | -2.45 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|