C18H33NNaO5+ — CID 101281923
sodium 2-[1-carboxypropyl-(2-hydroxyethyl)-[(E)-oct-2-enyl]azaniumyl]butanoate (PubChem CID 101281923) has the molecular formula C18H33NNaO5+ and a molecular weight of 366.45 g/mol. Its IUPAC name is sodium 2-[1-carboxypropyl-(2-hydroxyethyl)-[(E)-oct-2-enyl]azaniumyl]butanoate.
| Compound Name | sodium 2-[1-carboxypropyl-(2-hydroxyethyl)-[(E)-oct-2-enyl]azaniumyl]butanoate |
|---|---|
| PubChem CID | 101281923 |
| Molecular Formula | C18H33NNaO5+ |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | sodium 2-[1-carboxypropyl-(2-hydroxyethyl)-[(E)-oct-2-enyl]azaniumyl]butanoate |
| SMILES | CCCCC/C=C/C[N+](CCO)(C(CC)C(=O)[O-])C(CC)C(=O)O.[Na+] |
| InChI | InChI=1S/C18H33NO5.Na/c1-4-7-8-9-10-11-12-19(13-14-20,15(5-2)17(21)22)16(6-3)18(23)24;/h10-11,15-16,20H,4-9,12-14H2,1-3H3,(H-,21,22,23,24);/q;+1/b11-10+; |
| InChIKey | ZNMYRCJTKXLNPY-ASTDGNLGSA-N |
| XLogP | -1.67 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|