C26H47NO6 — CID 177483250
2-[bis(1-carboxybutyl)-[(Z)-undec-3-enyl]azaniumyl]pentanoate (PubChem CID 177483250) has the molecular formula C26H47NO6 and a molecular weight of 469.66 g/mol. Its IUPAC name is 2-[bis(1-carboxybutyl)-[(Z)-undec-3-enyl]azaniumyl]pentanoate.
| Compound Name | 2-[bis(1-carboxybutyl)-[(Z)-undec-3-enyl]azaniumyl]pentanoate |
|---|---|
| PubChem CID | 177483250 |
| Molecular Formula | C26H47NO6 |
| Molecular Weight | 469.66 g/mol |
| Exact Mass | 469.34 |
| IUPAC Name | 2-[bis(1-carboxybutyl)-[(Z)-undec-3-enyl]azaniumyl]pentanoate |
| SMILES | CCCCCCC/C=C\CC[N+](C(CCC)C(=O)[O-])(C(CCC)C(=O)O)C(CCC)C(=O)O |
| InChI | InChI=1S/C26H47NO6/c1-5-9-10-11-12-13-14-15-16-20-27(21(17-6-2)24(28)29,22(18-7-3)25(30)31)23(19-8-4)26(32)33/h14-15,21-23H,5-13,16-20H2,1-4H3,(H2-,28,29,30,31,32,33)/b15-14- |
| InChIKey | UVGGALQBAAPKMC-PFONDFGASA-N |
| XLogP | 4.54 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.66 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|