C33H61NO6 — CID 177422873
2-[bis(1-carboxybutyl)-[(E)-octadec-8-enyl]azaniumyl]pentanoate (PubChem CID 177422873) has the molecular formula C33H61NO6 and a molecular weight of 567.85 g/mol. Its IUPAC name is 2-[bis(1-carboxybutyl)-[(E)-octadec-8-enyl]azaniumyl]pentanoate.
| Compound Name | 2-[bis(1-carboxybutyl)-[(E)-octadec-8-enyl]azaniumyl]pentanoate |
|---|---|
| PubChem CID | 177422873 |
| Molecular Formula | C33H61NO6 |
| Molecular Weight | 567.85 g/mol |
| Exact Mass | 567.45 |
| IUPAC Name | 2-[bis(1-carboxybutyl)-[(E)-octadec-8-enyl]azaniumyl]pentanoate |
| SMILES | CCCCCCCCC/C=C/CCCCCCC[N+](C(CCC)C(=O)[O-])(C(CCC)C(=O)O)C(CCC)C(=O)O |
| InChI | InChI=1S/C33H61NO6/c1-5-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27-34(28(24-6-2)31(35)36,29(25-7-3)32(37)38)30(26-8-4)33(39)40/h16-17,28-30H,5-15,18-27H2,1-4H3,(H2-,35,36,37,38,39,40)/b17-16+ |
| InChIKey | QFFIJTGEPIVMQQ-WUKNDPDISA-N |
| XLogP | 7.27 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.85 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|