C30H45N5O8 — CID 177433625
tert-butyl N-[N'-[1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(4-methoxyphenyl)methylcarbamoylamino]pent-2-ynyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 177433625) has the molecular formula C30H45N5O8 and a molecular weight of 603.72 g/mol. Its IUPAC name is tert-butyl N-[N'-[1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(4-methoxyphenyl)methylcarbamoylamino]pent-2-ynyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(4-methoxyphenyl)methylcarbamoylamino]pent-2-ynyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 177433625 |
| Molecular Formula | C30H45N5O8 |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.33 |
| IUPAC Name | tert-butyl N-[N'-[1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(4-methoxyphenyl)methylcarbamoylamino]pent-2-ynyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | COc1ccc(CNC(=O)NCCC#CC(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)[C@H]2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C30H45N5O8/c1-28(2,3)42-26(37)34-24(35-27(38)43-29(4,5)6)33-22(23-19-40-30(7,8)41-23)12-10-11-17-31-25(36)32-18-20-13-15-21(39-9)16-14-20/h13-16,22-23H,11,17-19H2,1-9H3,(H2,31,32,36)(H2,33,34,35,37,38)/t22?,23-/m1/s1 |
| InChIKey | GJJGBWXJBYAUND-OZAIVSQSSA-N |
| XLogP | 3.81 |
| TPSA | 157.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|