C27H46O4 — CID 177434183
(5S,7R,8R,9S,10S,13R,14S,17R)-17-[(2R,5S)-5-hydroxy-6-methylhept-3-en-2-yl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,3,7-triol (PubChem CID 177434183) has the molecular formula C27H46O4 and a molecular weight of 434.66 g/mol. Its IUPAC name is (5S,7R,8R,9S,10S,13R,14S,17R)-17-[(2R,5S)-5-hydroxy-6-methylhept-3-en-2-yl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,3,7-triol.
| Compound Name | (5S,7R,8R,9S,10S,13R,14S,17R)-17-[(2R,5S)-5-hydroxy-6-methylhept-3-en-2-yl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,3,7-triol |
|---|---|
| PubChem CID | 177434183 |
| Molecular Formula | C27H46O4 |
| Molecular Weight | 434.66 g/mol |
| Exact Mass | 434.34 |
| IUPAC Name | (5S,7R,8R,9S,10S,13R,14S,17R)-17-[(2R,5S)-5-hydroxy-6-methylhept-3-en-2-yl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,3,7-triol |
| SMILES | CC(C)[C@H](O)C=C[C@@H](C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)C[C@H]4CC(O)(O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H46O4/c1-16(2)22(28)9-6-17(3)19-7-8-20-24-21(10-11-26(19,20)5)25(4)12-13-27(30,31)15-18(25)14-23(24)29/h6,9,16-24,28-31H,7-8,10-15H2,1-5H3/t17-,18+,19-,20+,21+,22-,23-,24+,25+,26-/m1/s1 |
| InChIKey | ZIGQRZLYIUEFLQ-CTGXEAEYSA-N |
| XLogP | 4.51 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.66 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|