C14H13Cl3O4 — CID 177437433
(3-methyl-1-benzofuran-2-yl) (1,1,1-trichloro-2-methylpropan-2-yl) carbonate (PubChem CID 177437433) has the molecular formula C14H13Cl3O4 and a molecular weight of 351.61 g/mol. Its IUPAC name is (3-methyl-1-benzofuran-2-yl) (1,1,1-trichloro-2-methylpropan-2-yl) carbonate.
| Compound Name | (3-methyl-1-benzofuran-2-yl) (1,1,1-trichloro-2-methylpropan-2-yl) carbonate |
|---|---|
| PubChem CID | 177437433 |
| Molecular Formula | C14H13Cl3O4 |
| Molecular Weight | 351.61 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | (3-methyl-1-benzofuran-2-yl) (1,1,1-trichloro-2-methylpropan-2-yl) carbonate |
| SMILES | Cc1c(OC(=O)OC(C)(C)C(Cl)(Cl)Cl)oc2ccccc12 |
| InChI | InChI=1S/C14H13Cl3O4/c1-8-9-6-4-5-7-10(9)19-11(8)20-12(18)21-13(2,3)14(15,16)17/h4-7H,1-3H3 |
| InChIKey | XBBKXXHOLJBIKE-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.61 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|