C16H18O2 — CID 177439433
ethyl (2Z)-2-(2,6-dimethylinden-1-ylidene)propanoate (PubChem CID 177439433) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is ethyl (2Z)-2-(2,6-dimethylinden-1-ylidene)propanoate.
| Compound Name | ethyl (2Z)-2-(2,6-dimethylinden-1-ylidene)propanoate |
|---|---|
| PubChem CID | 177439433 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | ethyl (2Z)-2-(2,6-dimethylinden-1-ylidene)propanoate |
| SMILES | CCOC(=O)/C(C)=C1/C(C)=Cc2ccc(C)cc21 |
| InChI | InChI=1S/C16H18O2/c1-5-18-16(17)12(4)15-11(3)9-13-7-6-10(2)8-14(13)15/h6-9H,5H2,1-4H3/b15-12- |
| InChIKey | ACOQVRNRYFINSA-QINSGFPZSA-N |
| XLogP | 3.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|