C17H26O2Si — CID 177443047
(Z)-5-[benzyl(dimethyl)silyl]-2-propan-2-ylpent-4-enoic acid (PubChem CID 177443047) has the molecular formula C17H26O2Si and a molecular weight of 290.48 g/mol. Its IUPAC name is (Z)-5-[benzyl(dimethyl)silyl]-2-propan-2-ylpent-4-enoic acid.
| Compound Name | (Z)-5-[benzyl(dimethyl)silyl]-2-propan-2-ylpent-4-enoic acid |
|---|---|
| PubChem CID | 177443047 |
| Molecular Formula | C17H26O2Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | (Z)-5-[benzyl(dimethyl)silyl]-2-propan-2-ylpent-4-enoic acid |
| SMILES | CC(C)C(C/C=C\[Si](C)(C)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H26O2Si/c1-14(2)16(17(18)19)11-8-12-20(3,4)13-15-9-6-5-7-10-15/h5-10,12,14,16H,11,13H2,1-4H3,(H,18,19)/b12-8- |
| InChIKey | JZSPFDUVGPEOOY-WQLSENKSSA-N |
| XLogP | 4.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|