C16H24ClNO2 — CID 88545061
(E,2S)-5-chloro-2-propan-2-ylpent-4-enoic acid;2-phenylethanamine (PubChem CID 88545061) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is (E,2S)-5-chloro-2-propan-2-ylpent-4-enoic acid;2-phenylethanamine.
| Compound Name | (E,2S)-5-chloro-2-propan-2-ylpent-4-enoic acid;2-phenylethanamine |
|---|---|
| PubChem CID | 88545061 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | (E,2S)-5-chloro-2-propan-2-ylpent-4-enoic acid;2-phenylethanamine |
| SMILES | CC(C)C(C/C=C/Cl)C(=O)O.NCCc1ccccc1 |
| InChI | InChI=1S/C8H13ClO2.C8H11N/c1-6(2)7(8(10)11)4-3-5-9;9-7-6-8-4-2-1-3-5-8/h3,5-7H,4H2,1-2H3,(H,10,11);1-5H,6-7,9H2/b5-3+; |
| InChIKey | JHXVAHMBBMJOEH-WGCWOXMQSA-N |
| XLogP | 3.67 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |