About 3-methylbut-2-enoyl chloride;2-phenylethanamine
3-methylbut-2-enoyl chloride;2-phenylethanamine (PubChem CID 158406537) has the molecular formula C13H18ClNO
and a molecular weight of 239.75 g/mol. Its IUPAC name is 3-methylbut-2-enoyl chloride;2-phenylethanamine.
Molecular Properties
| Compound Name | 3-methylbut-2-enoyl chloride;2-phenylethanamine |
| PubChem CID | 158406537 |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 3-methylbut-2-enoyl chloride;2-phenylethanamine |
| SMILES | CC(C)=CC(=O)Cl.NCCc1ccccc1 |
| InChI | InChI=1S/C8H11N.C5H7ClO/c9-7-6-8-4-2-1-3-5-8;1-4(2)3-5(6)7/h1-5H,6-7,9H2;3H,1-2H3 |
| InChIKey | GYTQSMBHMQHREX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbut-2-enoyl chloride;2-phenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbut-2-enoyl chloride;2-phenylethanamine?
The IUPAC name of 3-methylbut-2-enoyl chloride;2-phenylethanamine (CID 158406537) is 3-methylbut-2-enoyl chloride;2-phenylethanamine.
What is the SMILES notation for 3-methylbut-2-enoyl chloride;2-phenylethanamine?
The canonical SMILES for 3-methylbut-2-enoyl chloride;2-phenylethanamine is CC(C)=CC(=O)Cl.NCCc1ccccc1.
What is the InChIKey of 3-methylbut-2-enoyl chloride;2-phenylethanamine?
The InChIKey is GYTQSMBHMQHREX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C5H7ClO/c9-7-6-8-4-2-1-3-5-8;1-4(2)3-5(6)7/h1-5H,6-7,9H2;3H,1-2H3.
What are the key properties of 3-methylbut-2-enoyl chloride;2-phenylethanamine?
3-methylbut-2-enoyl chloride;2-phenylethanamine has a molecular weight of 239.75 g/mol, XLogP of 2.91, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-2-enoyl chloride;2-phenylethanamine is sourced from PubChem (CID 158406537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).