C19H17N5O3S — CID 177445778
S-[(2E)-2-[(E)-3-(4-methoxyphenyl)prop-2-enylidene]hydrazinyl] N-[(2-hydroxy-1H-indol-3-yl)imino]carbamothioate (PubChem CID 177445778) has the molecular formula C19H17N5O3S and a molecular weight of 395.44 g/mol. Its IUPAC name is S-[(2E)-2-[(E)-3-(4-methoxyphenyl)prop-2-enylidene]hydrazinyl] N-[(2-hydroxy-1H-indol-3-yl)imino]carbamothioate.
| Compound Name | S-[(2E)-2-[(E)-3-(4-methoxyphenyl)prop-2-enylidene]hydrazinyl] N-[(2-hydroxy-1H-indol-3-yl)imino]carbamothioate |
|---|---|
| PubChem CID | 177445778 |
| Molecular Formula | C19H17N5O3S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | S-[(2E)-2-[(E)-3-(4-methoxyphenyl)prop-2-enylidene]hydrazinyl] N-[(2-hydroxy-1H-indol-3-yl)imino]carbamothioate |
| SMILES | COc1ccc(/C=C/C=N/NSC(=O)/N=N/c2c(O)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C19H17N5O3S/c1-27-14-10-8-13(9-11-14)5-4-12-20-24-28-19(26)23-22-17-15-6-2-3-7-16(15)21-18(17)25/h2-12,21,24-25H,1H3/b5-4+,20-12+,23-22+ |
| InChIKey | DSHGGSOBGVAOPE-PMGIRWSGSA-N |
| XLogP | 5.02 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|