C19H16N4O4 — CID 175415710
(E)-N-[(2-hydroxy-1H-indol-3-yl)iminocarbamoyl]-3-(3-methoxyphenyl)prop-2-enamide (PubChem CID 175415710) has the molecular formula C19H16N4O4 and a molecular weight of 364.36 g/mol. Its IUPAC name is (E)-N-[(2-hydroxy-1H-indol-3-yl)iminocarbamoyl]-3-(3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(2-hydroxy-1H-indol-3-yl)iminocarbamoyl]-3-(3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 175415710 |
| Molecular Formula | C19H16N4O4 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (E)-N-[(2-hydroxy-1H-indol-3-yl)iminocarbamoyl]-3-(3-methoxyphenyl)prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)NC(=O)/N=N/c2c(O)[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C19H16N4O4/c1-27-13-6-4-5-12(11-13)9-10-16(24)21-19(26)23-22-17-14-7-2-3-8-15(14)20-18(17)25/h2-11,20,25H,1H3,(H,21,24,26)/b10-9+,23-22+ |
| InChIKey | PFELWXCOMFTXQZ-OVEXIPILSA-N |
| XLogP | 3.92 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|