C24H22N2O2 — CID 27397395
(E)-N-(8-ethyl-9H-carbazol-2-yl)-3-(3-methoxyphenyl)prop-2-enamide (PubChem CID 27397395) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is (E)-N-(8-ethyl-9H-carbazol-2-yl)-3-(3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(8-ethyl-9H-carbazol-2-yl)-3-(3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 27397395 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | (E)-N-(8-ethyl-9H-carbazol-2-yl)-3-(3-methoxyphenyl)prop-2-enamide |
| SMILES | CCc1cccc2c1[nH]c1cc(NC(=O)/C=C/c3cccc(OC)c3)ccc12 |
| InChI | InChI=1S/C24H22N2O2/c1-3-17-7-5-9-21-20-12-11-18(15-22(20)26-24(17)21)25-23(27)13-10-16-6-4-8-19(14-16)28-2/h4-15,26H,3H2,1-2H3,(H,25,27)/b13-10+ |
| InChIKey | ZTPANGQIAAJHRH-JLHYYAGUSA-N |
| XLogP | 5.54 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|