C14H12N4O5 — CID 175905755
[(E)-3-[(2-hydroxy-1H-indol-3-yl)iminocarbamoylamino]-3-oxoprop-1-enyl] acetate (PubChem CID 175905755) has the molecular formula C14H12N4O5 and a molecular weight of 316.27 g/mol. Its IUPAC name is [(E)-3-[(2-hydroxy-1H-indol-3-yl)iminocarbamoylamino]-3-oxoprop-1-enyl] acetate.
| Compound Name | [(E)-3-[(2-hydroxy-1H-indol-3-yl)iminocarbamoylamino]-3-oxoprop-1-enyl] acetate |
|---|---|
| PubChem CID | 175905755 |
| Molecular Formula | C14H12N4O5 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | [(E)-3-[(2-hydroxy-1H-indol-3-yl)iminocarbamoylamino]-3-oxoprop-1-enyl] acetate |
| SMILES | CC(=O)O/C=C/C(=O)NC(=O)/N=N/c1c(O)[nH]c2ccccc12 |
| InChI | InChI=1S/C14H12N4O5/c1-8(19)23-7-6-11(20)16-14(22)18-17-12-9-4-2-3-5-10(9)15-13(12)21/h2-7,15,21H,1H3,(H,16,20,22)/b7-6+,18-17+ |
| InChIKey | ADHTZJLRMAKDNK-QRNOYXLNSA-N |
| XLogP | 2.27 |
| TPSA | 133.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|