C16H25N4O3+ — CID 177446626
trimethyl-[(1S,2S)-2-[(3-nitrophenyl)carbamoylamino]cyclohexyl]azanium (PubChem CID 177446626) has the molecular formula C16H25N4O3+ and a molecular weight of 321.40 g/mol. Its IUPAC name is trimethyl-[(1S,2S)-2-[(3-nitrophenyl)carbamoylamino]cyclohexyl]azanium.
| Compound Name | trimethyl-[(1S,2S)-2-[(3-nitrophenyl)carbamoylamino]cyclohexyl]azanium |
|---|---|
| PubChem CID | 177446626 |
| Molecular Formula | C16H25N4O3+ |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | trimethyl-[(1S,2S)-2-[(3-nitrophenyl)carbamoylamino]cyclohexyl]azanium |
| SMILES | C[N+](C)(C)[C@H]1CCCC[C@@H]1NC(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H24N4O3/c1-20(2,3)15-10-5-4-9-14(15)18-16(21)17-12-7-6-8-13(11-12)19(22)23/h6-8,11,14-15H,4-5,9-10H2,1-3H3,(H-,17,18,21)/p+1/t14-,15-/m0/s1 |
| InChIKey | CSLWGVOWCAJKGG-GJZGRUSLSA-O |
| XLogP | 2.73 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|