C28H54N4O4 — CID 177447848
(N'Z)-N'-heptylidene-N-[7-[(Z)-[(7E)-7-hydroxyiminoheptylidene]-oxidoazaniumyl]heptyl]heptane-1,7-diimine oxide (PubChem CID 177447848) has the molecular formula C28H54N4O4 and a molecular weight of 510.76 g/mol. Its IUPAC name is (N'Z)-N'-heptylidene-N-[7-[(Z)-[(7E)-7-hydroxyiminoheptylidene]-oxidoazaniumyl]heptyl]heptane-1,7-diimine oxide.
| Compound Name | (N'Z)-N'-heptylidene-N-[7-[(Z)-[(7E)-7-hydroxyiminoheptylidene]-oxidoazaniumyl]heptyl]heptane-1,7-diimine oxide |
|---|---|
| PubChem CID | 177447848 |
| Molecular Formula | C28H54N4O4 |
| Molecular Weight | 510.76 g/mol |
| Exact Mass | 510.41 |
| IUPAC Name | (N'Z)-N'-heptylidene-N-[7-[(Z)-[(7E)-7-hydroxyiminoheptylidene]-oxidoazaniumyl]heptyl]heptane-1,7-diimine oxide |
| SMILES | CCCCCC/C=[N+](\[O-])CCCCCC/C=[N+](\[O-])CCCCCCC/[N+]([O-])=C/CCCCC/C=N/O |
| InChI | InChI=1S/C28H54N4O4/c1-2-3-4-9-16-23-30(34)25-18-11-6-13-20-27-32(36)28-21-14-7-12-19-26-31(35)24-17-10-5-8-15-22-29-33/h22-24,27,33H,2-21,25-26,28H2,1H3/b29-22+,30-23-,31-24-,32-27- |
| InChIKey | OYBDQEDLBSWFCI-ARHHZROLSA-N |
| XLogP | 7.01 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.76 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|