About CID 177449695
CID 177449695 (PubChem CID 177449695) has the molecular formula C14H17Li
and a molecular weight of 192.23 g/mol.
Molecular Properties
| Compound Name | CID 177449695 |
| PubChem CID | 177449695 |
| Molecular Formula | C14H17Li |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | — |
| SMILES | [Li+].c1ccc(C23CC[C-](CC2)CC3)cc1 |
| InChI | InChI=1S/C14H17.Li/c1-2-4-13(5-3-1)14-9-6-12(7-10-14)8-11-14;/h1-5H,6-11H2;/q-1;+1 |
| InChIKey | QJMKSQZGBIUEIW-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 177449695 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177449695?
The IUPAC name of CID 177449695 (CID 177449695) is not available.
What is the SMILES notation for CID 177449695?
The canonical SMILES for CID 177449695 is [Li+].c1ccc(C23CC[C-](CC2)CC3)cc1.
What is the InChIKey of CID 177449695?
The InChIKey is QJMKSQZGBIUEIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17.Li/c1-2-4-13(5-3-1)14-9-6-12(7-10-14)8-11-14;/h1-5H,6-11H2;/q-1;+1.
What are the key properties of CID 177449695?
CID 177449695 has a molecular weight of 192.23 g/mol, XLogP of 0.87, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177449695 is sourced from PubChem (CID 177449695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).