C34H42N2O8S2 — CID 177450144
3-[(2E)-2-[[2-hydroxy-4-oxo-3-[(E)-[3,3,5-trimethyl-1-(3-sulfopropyl)indol-2-ylidene]methyl]cyclobut-2-en-1-yl]methylidene]-3,3,5-trimethylindol-1-yl]propane-1-sulfonic acid (PubChem CID 177450144) has the molecular formula C34H42N2O8S2 and a molecular weight of 670.85 g/mol. Its IUPAC name is 3-[(2E)-2-[[2-hydroxy-4-oxo-3-[(E)-[3,3,5-trimethyl-1-(3-sulfopropyl)indol-2-ylidene]methyl]cyclobut-2-en-1-yl]methylidene]-3,3,5-trimethylindol-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[(2E)-2-[[2-hydroxy-4-oxo-3-[(E)-[3,3,5-trimethyl-1-(3-sulfopropyl)indol-2-ylidene]methyl]cyclobut-2-en-1-yl]methylidene]-3,3,5-trimethylindol-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 177450144 |
| Molecular Formula | C34H42N2O8S2 |
| Molecular Weight | 670.85 g/mol |
| Exact Mass | 670.24 |
| IUPAC Name | 3-[(2E)-2-[[2-hydroxy-4-oxo-3-[(E)-[3,3,5-trimethyl-1-(3-sulfopropyl)indol-2-ylidene]methyl]cyclobut-2-en-1-yl]methylidene]-3,3,5-trimethylindol-1-yl]propane-1-sulfonic acid |
| SMILES | Cc1ccc2c(c1)C(C)(C)/C(=C\C1=C(O)C(/C=C3/N(CCCS(=O)(=O)O)c4ccc(C)cc4C3(C)C)C1=O)N2CCCS(=O)(=O)O |
| InChI | InChI=1S/C34H42N2O8S2/c1-21-9-11-27-25(17-21)33(3,4)29(35(27)13-7-15-45(39,40)41)19-23-31(37)24(32(23)38)20-30-34(5,6)26-18-22(2)10-12-28(26)36(30)14-8-16-46(42,43)44/h9-12,17-20,23,37H,7-8,13-16H2,1-6H3,(H,39,40,41)(H,42,43,44)/b29-19+,30-20+ |
| InChIKey | HTTYCLYCEBUAJP-CZYCKNNWSA-N |
| XLogP | 5.53 |
| TPSA | 152.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.85 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|