C124H134Cl8N8O24 — CID 177450369
CID 177450369 (PubChem CID 177450369) has the molecular formula C124H134Cl8N8O24 and a molecular weight of 2404.09 g/mol.
| Compound Name | CID 177450369 |
|---|---|
| PubChem CID | 177450369 |
| Molecular Formula | C124H134Cl8N8O24 |
| Molecular Weight | 2404.09 g/mol |
| Exact Mass | 2398.70 |
| IUPAC Name | — |
| SMILES | CCCCCOc1c(Cl)c(Cl)c2c3c1-c1nc-3nc3[nH]c(nc4nc5nc6[nH]c(n1)c1c(OCCCCC)c(Cl)c(Cl)c(c61)OCCOCCOCCOCCOc1ccc6ccccc6c1-c1c(ccc6ccccc16)OCCOCCOCCOCCOc1c(Cl)c(Cl)c(OCCCCC)c-4c1-5)c1c(OCCCCC)c(Cl)c(Cl)c(c31)OCCOCCOCCOCCOc1ccc3ccccc3c1-c1c(ccc3ccccc13)OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C124H134Cl8N8O24/c1-5-9-21-41-157-109-93-97-113(105(129)101(109)125)161-73-65-149-57-49-141-45-53-145-61-69-153-85-37-33-77-25-13-17-29-81(77)89(85)90-82-30-18-14-26-78(82)34-38-86(90)155-71-63-147-55-47-143-51-59-151-67-75-163-115-99-95(111(103(127)107(115)131)159-43-23-11-7-3)119-134-120-96-100-116(108(132)104(128)112(96)160-44-24-12-8-4)164-76-68-152-60-52-144-48-56-148-64-72-156-88-40-36-80-28-16-20-32-84(80)92(88)91-83-31-19-15-27-79(83)35-39-87(91)154-70-62-146-54-46-142-50-58-150-66-74-162-114-98-94(110(102(126)106(114)130)158-42-22-10-6-2)118(136-123(98)140-124(100)138-120)133-117(93)135-121(97)139-122(99)137-119/h13-20,25-40H,5-12,21-24,41-76H2,1-4H3,(H2,133,134,135,136,137,138,139,140) |
| InChIKey | VRDHRPZLUXVACX-UHFFFAOYSA-N |
| XLogP | 28.98 |
| TPSA | 330.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 30 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 164 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 2404.09 |
| LogP ≤ 5 | 28.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 30 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|