C16H16N2O4 — CID 177450690
3-[2-[(E)-hydroxyiminomethyl]-1-(methoxymethyl)indol-3-yl]prop-2-ynyl acetate (PubChem CID 177450690) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is 3-[2-[(E)-hydroxyiminomethyl]-1-(methoxymethyl)indol-3-yl]prop-2-ynyl acetate.
| Compound Name | 3-[2-[(E)-hydroxyiminomethyl]-1-(methoxymethyl)indol-3-yl]prop-2-ynyl acetate |
|---|---|
| PubChem CID | 177450690 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 3-[2-[(E)-hydroxyiminomethyl]-1-(methoxymethyl)indol-3-yl]prop-2-ynyl acetate |
| SMILES | COCn1c(/C=N/O)c(C#CCOC(C)=O)c2ccccc21 |
| InChI | InChI=1S/C16H16N2O4/c1-12(19)22-9-5-7-14-13-6-3-4-8-15(13)18(11-21-2)16(14)10-17-20/h3-4,6,8,10,20H,9,11H2,1-2H3/b17-10+ |
| InChIKey | RTWOAWAMMPIPSP-LICLKQGHSA-N |
| XLogP | 1.97 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|