C17H13N3O3 — CID 135863006
methyl 1-[(E)-hydroxyiminomethyl]-9-prop-2-ynylpyrido[3,4-b]indole-3-carboxylate (PubChem CID 135863006) has the molecular formula C17H13N3O3 and a molecular weight of 307.31 g/mol. Its IUPAC name is methyl 1-[(E)-hydroxyiminomethyl]-9-prop-2-ynylpyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl 1-[(E)-hydroxyiminomethyl]-9-prop-2-ynylpyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 135863006 |
| Molecular Formula | C17H13N3O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | methyl 1-[(E)-hydroxyiminomethyl]-9-prop-2-ynylpyrido[3,4-b]indole-3-carboxylate |
| SMILES | C#CCn1c2ccccc2c2cc(C(=O)OC)nc(/C=N/O)c21 |
| InChI | InChI=1S/C17H13N3O3/c1-3-8-20-15-7-5-4-6-11(15)12-9-13(17(21)23-2)19-14(10-18-22)16(12)20/h1,4-7,9-10,22H,8H2,2H3/b18-10+ |
| InChIKey | XKCHBUPNZCMYQF-VCHYOVAHSA-N |
| XLogP | 2.42 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|