C16H15N3O2 — CID 14669046
methyl 3-methyl-1,3,6-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10,12,14-hexaene-7-carboxylate (PubChem CID 14669046) has the molecular formula C16H15N3O2 and a molecular weight of 281.32 g/mol. Its IUPAC name is methyl 3-methyl-1,3,6-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10,12,14-hexaene-7-carboxylate.
| Compound Name | methyl 3-methyl-1,3,6-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10,12,14-hexaene-7-carboxylate |
|---|---|
| PubChem CID | 14669046 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | methyl 3-methyl-1,3,6-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10,12,14-hexaene-7-carboxylate |
| SMILES | COC(=O)c1cc2c3ccccc3n3c2c(n1)CN(C)C3 |
| InChI | InChI=1S/C16H15N3O2/c1-18-8-13-15-11(7-12(17-13)16(20)21-2)10-5-3-4-6-14(10)19(15)9-18/h3-7H,8-9H2,1-2H3 |
| InChIKey | FPIOYVGZIPUPHF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |