C24H27BrO7 — CID 177453040
4-O-ethyl 7-O,7-O'-dimethyl 1-(4-bromophenyl)-3,5a-dimethyl-6,8-dihydro-5H-cyclopenta[c]oxepine-4,7,7-tricarboxylate (PubChem CID 177453040) has the molecular formula C24H27BrO7 and a molecular weight of 507.38 g/mol. Its IUPAC name is 4-O-ethyl 7-O,7-O'-dimethyl 1-(4-bromophenyl)-3,5a-dimethyl-6,8-dihydro-5H-cyclopenta[c]oxepine-4,7,7-tricarboxylate.
| Compound Name | 4-O-ethyl 7-O,7-O'-dimethyl 1-(4-bromophenyl)-3,5a-dimethyl-6,8-dihydro-5H-cyclopenta[c]oxepine-4,7,7-tricarboxylate |
|---|---|
| PubChem CID | 177453040 |
| Molecular Formula | C24H27BrO7 |
| Molecular Weight | 507.38 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | 4-O-ethyl 7-O,7-O'-dimethyl 1-(4-bromophenyl)-3,5a-dimethyl-6,8-dihydro-5H-cyclopenta[c]oxepine-4,7,7-tricarboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(c2ccc(Br)cc2)=C2CC(C(=O)OC)(C(=O)OC)CC2(C)C1 |
| InChI | InChI=1S/C24H27BrO7/c1-6-31-20(26)17-11-23(3)13-24(21(27)29-4,22(28)30-5)12-18(23)19(32-14(17)2)15-7-9-16(25)10-8-15/h7-10H,6,11-13H2,1-5H3 |
| InChIKey | POESFKUXJIMVST-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|