C18H21NO2 — CID 177453216
methyl (Z)-3-[benzyl-[[(1S)-cyclohexa-2,4-dien-1-yl]methyl]amino]prop-2-enoate (PubChem CID 177453216) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is methyl (Z)-3-[benzyl-[[(1S)-cyclohexa-2,4-dien-1-yl]methyl]amino]prop-2-enoate.
| Compound Name | methyl (Z)-3-[benzyl-[[(1S)-cyclohexa-2,4-dien-1-yl]methyl]amino]prop-2-enoate |
|---|---|
| PubChem CID | 177453216 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | methyl (Z)-3-[benzyl-[[(1S)-cyclohexa-2,4-dien-1-yl]methyl]amino]prop-2-enoate |
| SMILES | COC(=O)/C=C\N(Cc1ccccc1)C[C@@H]1C=CC=CC1 |
| InChI | InChI=1S/C18H21NO2/c1-21-18(20)12-13-19(14-16-8-4-2-5-9-16)15-17-10-6-3-7-11-17/h2-10,12-13,17H,11,14-15H2,1H3/b13-12-/t17-/m1/s1 |
| InChIKey | WBJGBJZVYVRVGC-MUSGIIIZSA-N |
| XLogP | 3.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|