C21H21O2P — CID 145289431
methyl 2-[cyclohexa-2,4-dien-1-yl(diphenyl)-λ5-phosphanylidene]acetate (PubChem CID 145289431) has the molecular formula C21H21O2P and a molecular weight of 336.37 g/mol. Its IUPAC name is methyl 2-[cyclohexa-2,4-dien-1-yl(diphenyl)-λ5-phosphanylidene]acetate.
| Compound Name | methyl 2-[cyclohexa-2,4-dien-1-yl(diphenyl)-λ5-phosphanylidene]acetate |
|---|---|
| PubChem CID | 145289431 |
| Molecular Formula | C21H21O2P |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | methyl 2-[cyclohexa-2,4-dien-1-yl(diphenyl)-λ5-phosphanylidene]acetate |
| SMILES | COC(=O)C=P(c1ccccc1)(c1ccccc1)C1C=CC=CC1 |
| InChI | InChI=1S/C21H21O2P/c1-23-21(22)17-24(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-15,17,20H,16H2,1H3 |
| InChIKey | BIOQQHIBICJZHN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|