C23H27O2P — CID 143257589
ethene;methyl 2-[[(2E,4Z)-hexa-2,4-dien-3-yl]-diphenyl-λ5-phosphanylidene]acetate (PubChem CID 143257589) has the molecular formula C23H27O2P and a molecular weight of 366.44 g/mol. Its IUPAC name is ethene;methyl 2-[[(2E,4Z)-hexa-2,4-dien-3-yl]-diphenyl-λ5-phosphanylidene]acetate.
| Compound Name | ethene;methyl 2-[[(2E,4Z)-hexa-2,4-dien-3-yl]-diphenyl-λ5-phosphanylidene]acetate |
|---|---|
| PubChem CID | 143257589 |
| Molecular Formula | C23H27O2P |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | ethene;methyl 2-[[(2E,4Z)-hexa-2,4-dien-3-yl]-diphenyl-λ5-phosphanylidene]acetate |
| SMILES | C/C=C\C(=C/C)P(=CC(=O)OC)(c1ccccc1)c1ccccc1.C=C |
| InChI | InChI=1S/C21H23O2P.C2H4/c1-4-12-18(5-2)24(17-21(22)23-3,19-13-8-6-9-14-19)20-15-10-7-11-16-20;1-2/h4-17H,1-3H3;1-2H2/b12-4-,18-5+; |
| InChIKey | LKSIYSGMBPDARY-SFDQNODBSA-N |
| XLogP | 4.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|