C19H21O2P — CID 89336042
(Z)-1-[[(2E,4Z)-hepta-2,4,6-trien-3-yl]-phenylphosphoryl]-2-methylidenepent-3-en-1-one (PubChem CID 89336042) has the molecular formula C19H21O2P and a molecular weight of 312.35 g/mol. Its IUPAC name is (Z)-1-[[(2E,4Z)-hepta-2,4,6-trien-3-yl]-phenylphosphoryl]-2-methylidenepent-3-en-1-one.
| Compound Name | (Z)-1-[[(2E,4Z)-hepta-2,4,6-trien-3-yl]-phenylphosphoryl]-2-methylidenepent-3-en-1-one |
|---|---|
| PubChem CID | 89336042 |
| Molecular Formula | C19H21O2P |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | (Z)-1-[[(2E,4Z)-hepta-2,4,6-trien-3-yl]-phenylphosphoryl]-2-methylidenepent-3-en-1-one |
| SMILES | C=C/C=C\C(=C/C)P(=O)(C(=O)C(=C)/C=C\C)c1ccccc1 |
| InChI | InChI=1S/C19H21O2P/c1-5-8-13-17(7-3)22(21,18-14-10-9-11-15-18)19(20)16(4)12-6-2/h5-15H,1,4H2,2-3H3/b12-6-,13-8-,17-7+ |
| InChIKey | RPNDINPLUROYQU-LYNPJFSRSA-N |
| XLogP | 4.98 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|