C21H20O2 — CID 145204650
(5Z)-3-cyclohexa-2,4-dien-1-yl-6-methoxy-5-phenylocta-5,7-dien-1-yn-4-one (PubChem CID 145204650) has the molecular formula C21H20O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is (5Z)-3-cyclohexa-2,4-dien-1-yl-6-methoxy-5-phenylocta-5,7-dien-1-yn-4-one.
| Compound Name | (5Z)-3-cyclohexa-2,4-dien-1-yl-6-methoxy-5-phenylocta-5,7-dien-1-yn-4-one |
|---|---|
| PubChem CID | 145204650 |
| Molecular Formula | C21H20O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (5Z)-3-cyclohexa-2,4-dien-1-yl-6-methoxy-5-phenylocta-5,7-dien-1-yn-4-one |
| SMILES | C#CC(C(=O)/C(=C(/C=C)OC)c1ccccc1)C1C=CC=CC1 |
| InChI | InChI=1S/C21H20O2/c1-4-18(16-12-8-6-9-13-16)21(22)20(19(5-2)23-3)17-14-10-7-11-15-17/h1,5-12,14-16,18H,2,13H2,3H3/b20-19- |
| InChIKey | IXZPHJXABYZNSN-VXPUYCOJSA-N |
| XLogP | 4.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|