About [(E)-(4,4-dimethyl-1,4-benzoxasilin-3-ylidene)-phenylmethyl]-trimethylsilane
[(E)-(4,4-dimethyl-1,4-benzoxasilin-3-ylidene)-phenylmethyl]-trimethylsilane (PubChem CID 177454228) has the molecular formula C20H26OSi2
and a molecular weight of 338.60 g/mol. Its IUPAC name is [(E)-(4,4-dimethyl-1,4-benzoxasilin-3-ylidene)-phenylmethyl]-trimethylsilane.
Molecular Properties
| Compound Name | [(E)-(4,4-dimethyl-1,4-benzoxasilin-3-ylidene)-phenylmethyl]-trimethylsilane |
| PubChem CID | 177454228 |
| Molecular Formula | C20H26OSi2 |
| Molecular Weight | 338.60 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | [(E)-(4,4-dimethyl-1,4-benzoxasilin-3-ylidene)-phenylmethyl]-trimethylsilane |
| SMILES | C[Si](C)(C)/C(=C1\COc2ccccc2[Si]1(C)C)c1ccccc1 |
| InChI | InChI=1S/C20H26OSi2/c1-22(2,3)20(16-11-7-6-8-12-16)19-15-21-17-13-9-10-14-18(17)23(19,4)5/h6-14H,15H2,1-5H3/b20-19+ |
| InChIKey | IIIADLSKSACKJH-FMQUCBEESA-N |
| XLogP | 4.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.60 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(4,4-dimethyl-1,4-benzoxasilin-3-ylidene)-phenylmethyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(4,4-dimethyl-1,4-benzoxasilin-3-ylidene)-phenylmethyl]-trimethylsilane?
The IUPAC name of [(E)-(4,4-dimethyl-1,4-benzoxasilin-3-ylidene)-phenylmethyl]-trimethylsilane (CID 177454228) is [(E)-(4,4-dimethyl-1,4-benzoxasilin-3-ylidene)-phenylmethyl]-trimethylsilane.
What is the SMILES notation for [(E)-(4,4-dimethyl-1,4-benzoxasilin-3-ylidene)-phenylmethyl]-trimethylsilane?
The canonical SMILES for [(E)-(4,4-dimethyl-1,4-benzoxasilin-3-ylidene)-phenylmethyl]-trimethylsilane is C[Si](C)(C)/C(=C1\COc2ccccc2[Si]1(C)C)c1ccccc1.
What is the InChIKey of [(E)-(4,4-dimethyl-1,4-benzoxasilin-3-ylidene)-phenylmethyl]-trimethylsilane?
The InChIKey is IIIADLSKSACKJH-FMQUCBEESA-N. The full InChI is InChI=1S/C20H26OSi2/c1-22(2,3)20(16-11-7-6-8-12-16)19-15-21-17-13-9-10-14-18(17)23(19,4)5/h6-14H,15H2,1-5H3/b20-19+.
What are the key properties of [(E)-(4,4-dimethyl-1,4-benzoxasilin-3-ylidene)-phenylmethyl]-trimethylsilane?
[(E)-(4,4-dimethyl-1,4-benzoxasilin-3-ylidene)-phenylmethyl]-trimethylsilane has a molecular weight of 338.60 g/mol, XLogP of 4.86, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(4,4-dimethyl-1,4-benzoxasilin-3-ylidene)-phenylmethyl]-trimethylsilane is sourced from PubChem (CID 177454228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).