C20H26OSi2 — CID 177454228
[(E)-(4,4-dimethyl-1,4-benzoxasilin-3-ylidene)-phenylmethyl]-trimethylsilane (PubChem CID 177454228) has the molecular formula C20H26OSi2 and a molecular weight of 338.60 g/mol. Its IUPAC name is [(E)-(4,4-dimethyl-1,4-benzoxasilin-3-ylidene)-phenylmethyl]-trimethylsilane.
| Compound Name | [(E)-(4,4-dimethyl-1,4-benzoxasilin-3-ylidene)-phenylmethyl]-trimethylsilane |
|---|---|
| PubChem CID | 177454228 |
| Molecular Formula | C20H26OSi2 |
| Molecular Weight | 338.60 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | [(E)-(4,4-dimethyl-1,4-benzoxasilin-3-ylidene)-phenylmethyl]-trimethylsilane |
| SMILES | C[Si](C)(C)/C(=C1\COc2ccccc2[Si]1(C)C)c1ccccc1 |
| InChI | InChI=1S/C20H26OSi2/c1-22(2,3)20(16-11-7-6-8-12-16)19-15-21-17-13-9-10-14-18(17)23(19,4)5/h6-14H,15H2,1-5H3/b20-19+ |
| InChIKey | IIIADLSKSACKJH-FMQUCBEESA-N |
| XLogP | 4.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.60 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|