C33H35N3O6 — CID 177454530
6-(4-nitrophenyl)-13-tridecan-7-yl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 177454530) has the molecular formula C33H35N3O6 and a molecular weight of 569.66 g/mol. Its IUPAC name is 6-(4-nitrophenyl)-13-tridecan-7-yl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6-(4-nitrophenyl)-13-tridecan-7-yl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 177454530 |
| Molecular Formula | C33H35N3O6 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | 6-(4-nitrophenyl)-13-tridecan-7-yl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | CCCCCCC(CCCCCC)N1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)N(c1ccc([N+](=O)[O-])cc1)C3=O |
| InChI | InChI=1S/C33H35N3O6/c1-3-5-7-9-11-21(12-10-8-6-4-2)34-30(37)24-17-19-26-29-27(20-18-25(28(24)29)31(34)38)33(40)35(32(26)39)22-13-15-23(16-14-22)36(41)42/h13-21H,3-12H2,1-2H3 |
| InChIKey | BBVANWZSDUGWEN-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 117.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|