C28H37N3O6 — CID 139255366
2-(2-hexyldecyl)-6,7-dinitrobenzo[de]isoquinoline-1,3-dione (PubChem CID 139255366) has the molecular formula C28H37N3O6 and a molecular weight of 511.62 g/mol. Its IUPAC name is 2-(2-hexyldecyl)-6,7-dinitrobenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(2-hexyldecyl)-6,7-dinitrobenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 139255366 |
| Molecular Formula | C28H37N3O6 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | 2-(2-hexyldecyl)-6,7-dinitrobenzo[de]isoquinoline-1,3-dione |
| SMILES | CCCCCCCCC(CCCCCC)CN1C(=O)c2ccc([N+](=O)[O-])c3c([N+](=O)[O-])ccc(c23)C1=O |
| InChI | InChI=1S/C28H37N3O6/c1-3-5-7-9-10-12-14-20(13-11-8-6-4-2)19-29-27(32)21-15-17-23(30(34)35)26-24(31(36)37)18-16-22(25(21)26)28(29)33/h15-18,20H,3-14,19H2,1-2H3 |
| InChIKey | YBSHGANABJGAEI-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|