About nickel(2+);bis((7-sulfinatonaphthalen-2-yl) benzoate)
nickel(2+);bis((7-sulfinatonaphthalen-2-yl) benzoate) (PubChem CID 177455853) has the molecular formula C34H22NiO8S2
and a molecular weight of 681.37 g/mol. Its IUPAC name is nickel(2+);bis((7-sulfinatonaphthalen-2-yl) benzoate).
Molecular Properties
| Compound Name | nickel(2+);bis((7-sulfinatonaphthalen-2-yl) benzoate) |
| PubChem CID | 177455853 |
| Molecular Formula | C34H22NiO8S2 |
| Molecular Weight | 681.37 g/mol |
| Exact Mass | 680.01 |
| IUPAC Name | nickel(2+);bis((7-sulfinatonaphthalen-2-yl) benzoate) |
| SMILES | O=C(Oc1ccc2ccc([S-](=O)=O)cc2c1)c1ccccc1.O=C(Oc1ccc2ccc([S-](=O)=O)cc2c1)c1ccccc1.[Ni+2] |
| InChI | InChI=1S/2C17H11O4S.Ni/c2*18-17(13-4-2-1-3-5-13)21-15-8-6-12-7-9-16(22(19)20)11-14(12)10-15;/h2*1-11H;/q2*-1;+2 |
| InChIKey | PVOJHWDXYNXNTG-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 681.37 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze nickel(2+);bis((7-sulfinatonaphthalen-2-yl) benzoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel(2+);bis((7-sulfinatonaphthalen-2-yl) benzoate)?
The IUPAC name of nickel(2+);bis((7-sulfinatonaphthalen-2-yl) benzoate) (CID 177455853) is nickel(2+);bis((7-sulfinatonaphthalen-2-yl) benzoate).
What is the SMILES notation for nickel(2+);bis((7-sulfinatonaphthalen-2-yl) benzoate)?
The canonical SMILES for nickel(2+);bis((7-sulfinatonaphthalen-2-yl) benzoate) is O=C(Oc1ccc2ccc([S-](=O)=O)cc2c1)c1ccccc1.O=C(Oc1ccc2ccc([S-](=O)=O)cc2c1)c1ccccc1.[Ni+2].
What is the InChIKey of nickel(2+);bis((7-sulfinatonaphthalen-2-yl) benzoate)?
The InChIKey is PVOJHWDXYNXNTG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C17H11O4S.Ni/c2*18-17(13-4-2-1-3-5-13)21-15-8-6-12-7-9-16(22(19)20)11-14(12)10-15;/h2*1-11H;/q2*-1;+2.
What are the key properties of nickel(2+);bis((7-sulfinatonaphthalen-2-yl) benzoate)?
nickel(2+);bis((7-sulfinatonaphthalen-2-yl) benzoate) has a molecular weight of 681.37 g/mol, XLogP of 7.45, 6 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for nickel(2+);bis((7-sulfinatonaphthalen-2-yl) benzoate) is sourced from PubChem (CID 177455853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).