C23H34O5 — CID 177456196
[(1R,4R,9S,10S,12R)-15,15-dimethoxy-5,5,9-trimethyl-16-oxo-3-tetracyclo[10.2.2.01,10.04,9]hexadec-13-enyl] acetate (PubChem CID 177456196) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is [(1R,4R,9S,10S,12R)-15,15-dimethoxy-5,5,9-trimethyl-16-oxo-3-tetracyclo[10.2.2.01,10.04,9]hexadec-13-enyl] acetate.
| Compound Name | [(1R,4R,9S,10S,12R)-15,15-dimethoxy-5,5,9-trimethyl-16-oxo-3-tetracyclo[10.2.2.01,10.04,9]hexadec-13-enyl] acetate |
|---|---|
| PubChem CID | 177456196 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | [(1R,4R,9S,10S,12R)-15,15-dimethoxy-5,5,9-trimethyl-16-oxo-3-tetracyclo[10.2.2.01,10.04,9]hexadec-13-enyl] acetate |
| SMILES | COC1(OC)C(=O)[C@H]2C=C[C@@]13CC(OC(C)=O)[C@@H]1C(C)(C)CCC[C@@]1(C)[C@@H]3C2 |
| InChI | InChI=1S/C23H34O5/c1-14(24)28-16-13-22-11-8-15(19(25)23(22,26-5)27-6)12-17(22)21(4)10-7-9-20(2,3)18(16)21/h8,11,15-18H,7,9-10,12-13H2,1-6H3/t15-,16?,17-,18+,21-,22-/m0/s1 |
| InChIKey | XENDQIACMHPLDH-IPUFFSCUSA-N |
| XLogP | 3.90 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|