C26H50O3Si — CID 177456760
(14S)-14-methyl-12-methylidene-11-tri(propan-2-yl)silyloxy-oxacyclohexadecan-2-one (PubChem CID 177456760) has the molecular formula C26H50O3Si and a molecular weight of 438.77 g/mol. Its IUPAC name is (14S)-14-methyl-12-methylidene-11-tri(propan-2-yl)silyloxy-oxacyclohexadecan-2-one.
| Compound Name | (14S)-14-methyl-12-methylidene-11-tri(propan-2-yl)silyloxy-oxacyclohexadecan-2-one |
|---|---|
| PubChem CID | 177456760 |
| Molecular Formula | C26H50O3Si |
| Molecular Weight | 438.77 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | (14S)-14-methyl-12-methylidene-11-tri(propan-2-yl)silyloxy-oxacyclohexadecan-2-one |
| SMILES | C=C1C[C@H](C)CCOC(=O)CCCCCCCCC1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H50O3Si/c1-20(2)30(21(3)4,22(5)6)29-25-15-13-11-9-10-12-14-16-26(27)28-18-17-23(7)19-24(25)8/h20-23,25H,8-19H2,1-7H3/t23-,25?/m1/s1 |
| InChIKey | YSQTXSHQFRMUNH-XQZUBTRRSA-N |
| XLogP | 8.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.77 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|