C36H34O16S8 — CID 177456825
dimethyl 2-[2,7,8-tris[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]octylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 177456825) has the molecular formula C36H34O16S8 and a molecular weight of 979.19 g/mol. Its IUPAC name is dimethyl 2-[2,7,8-tris[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]octylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[2,7,8-tris[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]octylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 177456825 |
| Molecular Formula | C36H34O16S8 |
| Molecular Weight | 979.19 g/mol |
| Exact Mass | 977.96 |
| IUPAC Name | dimethyl 2-[2,7,8-tris[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]octylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=CC(CCCCC(C=C2SC(C(=O)OC)=C(C(=O)OC)S2)=C2SC(C(=O)OC)=C(C(=O)OC)S2)=C2SC(C(=O)OC)=C(C(=O)OC)S2)S1 |
| InChI | InChI=1S/C36H34O16S8/c1-45-27(37)19-20(28(38)46-2)54-17(53-19)13-15(35-57-23(31(41)49-5)24(58-35)32(42)50-6)11-9-10-12-16(36-59-25(33(43)51-7)26(60-36)34(44)52-8)14-18-55-21(29(39)47-3)22(56-18)30(40)48-4/h13-14H,9-12H2,1-8H3 |
| InChIKey | UPXQSUWHBZPMCG-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 210.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 979.19 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'ene_one_one_A(1)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|