C28H26O8S8 — CID 102189579
dimethyl 2-[4-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-2,3-bis(4,5-dimethyl-1,3-dithiol-2-ylidene)butylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 102189579) has the molecular formula C28H26O8S8 and a molecular weight of 747.04 g/mol. Its IUPAC name is dimethyl 2-[4-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-2,3-bis(4,5-dimethyl-1,3-dithiol-2-ylidene)butylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[4-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-2,3-bis(4,5-dimethyl-1,3-dithiol-2-ylidene)butylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 102189579 |
| Molecular Formula | C28H26O8S8 |
| Molecular Weight | 747.04 g/mol |
| Exact Mass | 745.94 |
| IUPAC Name | dimethyl 2-[4-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-2,3-bis(4,5-dimethyl-1,3-dithiol-2-ylidene)butylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=CC(=C2SC(C)=C(C)S2)C(C=C2SC(C(=O)OC)=C(C(=O)OC)S2)=C2SC(C)=C(C)S2)S1 |
| InChI | InChI=1S/C28H26O8S8/c1-11-12(2)38-27(37-11)15(9-17-41-19(23(29)33-5)20(42-17)24(30)34-6)16(28-39-13(3)14(4)40-28)10-18-43-21(25(31)35-7)22(44-18)26(32)36-8/h9-10H,1-8H3 |
| InChIKey | SSXWKSHAIRPNIX-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.04 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'ene_one_one_A(1)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|