C24H20O12S6 — CID 101160239
dimethyl 2-[2,3-bis[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]propylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 101160239) has the molecular formula C24H20O12S6 and a molecular weight of 692.81 g/mol. Its IUPAC name is dimethyl 2-[2,3-bis[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]propylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[2,3-bis[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]propylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 101160239 |
| Molecular Formula | C24H20O12S6 |
| Molecular Weight | 692.81 g/mol |
| Exact Mass | 691.93 |
| IUPAC Name | dimethyl 2-[2,3-bis[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]propylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=CC(C=C2SC(C(=O)OC)=C(C(=O)OC)S2)=C2SC(C(=O)OC)=C(C(=O)OC)S2)S1 |
| InChI | InChI=1S/C24H20O12S6/c1-31-18(25)12-13(19(26)32-2)38-10(37-12)7-9(24-41-16(22(29)35-5)17(42-24)23(30)36-6)8-11-39-14(20(27)33-3)15(40-11)21(28)34-4/h7-8H,1-6H3 |
| InChIKey | GGLBNOGNKZJMAV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'ene_one_one_A(1)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|